N-β-(Aminoethyl)- γ-aminopropyl methyldimethoxysilane
Formula : NH2(CH2)2NH(CH2)3Si(OCH3)2CH3
|
Chemical Name |
N-beta-(Aminoethyl)-gamma-aminopropylmethyldimethoxysilane |
|
Formula |
C8H22N2O2Si |
|
Molecular Weight |
206.4 |
|
Boiling Point |
265℃【760mmHg】 |
|
Refractive Index |
1.445【25℃】 |
|
Density 25/25℃ |
0.970-0.980 |
|
Viscosity25℃ |
4.6mm2/s |
|
Amine number |
>9.4 |
|
Flash point |
93℃ |
|
Ignition temperature |
290℃ |
|
Min. Purity |
97.0% |
|
CAS No. |
3069-29-2 |
|
EINECS No. |
221-336-3 |
Solubility
WD-53 is easily soluble in water with spontaneous hydrolysis occurring. Caution: Due to solution enthalpies mixing water is exothermic. Always stir WD-53 into water. With alcohols miscibility is, in general, possible with self-catalyzed exchange of the alkoxy-groups. In aliphatic and aromatic hydrocarbons and (moisture-free!) ethers or esters WD-53 is easily soluble at differing levels. With ketones and various halogenated compounds a slow reaction can occur. Towards acids, epoxides or isocyanates WD-53 shows typical amine function. Some nonferrous metals can discolor upon contact.
Applications
l Provides superior elongation, flexibility and spreading at the interface as a coupling agent.
l Improves adhesion between glass, mineral and metal surfaces and amino-reactive resins.
l Improves adhesion, while maintaining good shelf stability as an additive in waterborne systems.